C25H30ClN3O2S — CID 67085076
N-cyclopentyl-3-[(9-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-5-yl)sulfonyl]aniline;hydrochloride (PubChem CID 67085076) has the molecular formula C25H30ClN3O2S and a molecular weight of 472.05 g/mol. Its IUPAC name is N-cyclopentyl-3-[(9-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-5-yl)sulfonyl]aniline;hydrochloride.
| Compound Name | N-cyclopentyl-3-[(9-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-5-yl)sulfonyl]aniline;hydrochloride |
|---|---|
| PubChem CID | 67085076 |
| Molecular Formula | C25H30ClN3O2S |
| Molecular Weight | 472.05 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | N-cyclopentyl-3-[(9-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-5-yl)sulfonyl]aniline;hydrochloride |
| SMILES | Cl.Cn1c2c(c3cc(S(=O)(=O)c4cccc(NC5CCCC5)c4)ccc31)C1CCC(C2)N1 |
| InChI | InChI=1S/C25H29N3O2S.ClH/c1-28-23-12-10-20(15-21(23)25-22-11-9-18(27-22)14-24(25)28)31(29,30)19-8-4-7-17(13-19)26-16-5-2-3-6-16;/h4,7-8,10,12-13,15-16,18,22,26-27H,2-3,5-6,9,11,14H2,1H3;1H |
| InChIKey | FAIWTUWCVGYZPO-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.05 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|