C22H21Cl2N3O2S — CID 72837029
5-(6-chloroindol-1-yl)sulfonyl-9-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene;hydrochloride (PubChem CID 72837029) has the molecular formula C22H21Cl2N3O2S and a molecular weight of 462.40 g/mol. Its IUPAC name is 5-(6-chloroindol-1-yl)sulfonyl-9-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene;hydrochloride.
| Compound Name | 5-(6-chloroindol-1-yl)sulfonyl-9-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene;hydrochloride |
|---|---|
| PubChem CID | 72837029 |
| Molecular Formula | C22H21Cl2N3O2S |
| Molecular Weight | 462.40 g/mol |
| Exact Mass | 461.07 |
| IUPAC Name | 5-(6-chloroindol-1-yl)sulfonyl-9-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene;hydrochloride |
| SMILES | Cl.Cn1c2c(c3cc(S(=O)(=O)n4ccc5ccc(Cl)cc54)ccc31)C1CCC(C2)N1 |
| InChI | InChI=1S/C22H20ClN3O2S.ClH/c1-25-19-7-5-16(12-17(19)22-18-6-4-15(24-18)11-21(22)25)29(27,28)26-9-8-13-2-3-14(23)10-20(13)26;/h2-3,5,7-10,12,15,18,24H,4,6,11H2,1H3;1H |
| InChIKey | CRLITLGORTURKJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 56.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.40 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|