C26H29BrN2O3 — CID 67085886
tert-butyl 5-bromo-9-methyl-7-phenylmethoxy-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene-4-carboxylate (PubChem CID 67085886) has the molecular formula C26H29BrN2O3 and a molecular weight of 497.43 g/mol. Its IUPAC name is tert-butyl 5-bromo-9-methyl-7-phenylmethoxy-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene-4-carboxylate.
| Compound Name | tert-butyl 5-bromo-9-methyl-7-phenylmethoxy-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene-4-carboxylate |
|---|---|
| PubChem CID | 67085886 |
| Molecular Formula | C26H29BrN2O3 |
| Molecular Weight | 497.43 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | tert-butyl 5-bromo-9-methyl-7-phenylmethoxy-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene-4-carboxylate |
| SMILES | Cn1c2c(c3c(C(=O)OC(C)(C)C)c(Br)cc(OCc4ccccc4)c31)C1CCC(C2)N1 |
| InChI | InChI=1S/C26H29BrN2O3/c1-26(2,3)32-25(30)21-17(27)13-20(31-14-15-8-6-5-7-9-15)24-23(21)22-18-11-10-16(28-18)12-19(22)29(24)4/h5-9,13,16,18,28H,10-12,14H2,1-4H3 |
| InChIKey | QGPPECQDDKNISP-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.43 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |