C31H31N3O6S — CID 67090900
N-[3-[benzenesulfonylcarbamoyl(methyl)amino]-5-tert-butyl-2-methoxyphenyl]-2-naphthalen-1-yl-2-oxoacetamide (PubChem CID 67090900) has the molecular formula C31H31N3O6S and a molecular weight of 573.67 g/mol. Its IUPAC name is N-[3-[benzenesulfonylcarbamoyl(methyl)amino]-5-tert-butyl-2-methoxyphenyl]-2-naphthalen-1-yl-2-oxoacetamide.
| Compound Name | N-[3-[benzenesulfonylcarbamoyl(methyl)amino]-5-tert-butyl-2-methoxyphenyl]-2-naphthalen-1-yl-2-oxoacetamide |
|---|---|
| PubChem CID | 67090900 |
| Molecular Formula | C31H31N3O6S |
| Molecular Weight | 573.67 g/mol |
| Exact Mass | 573.19 |
| IUPAC Name | N-[3-[benzenesulfonylcarbamoyl(methyl)amino]-5-tert-butyl-2-methoxyphenyl]-2-naphthalen-1-yl-2-oxoacetamide |
| SMILES | COc1c(NC(=O)C(=O)c2cccc3ccccc23)cc(C(C)(C)C)cc1N(C)C(=O)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C31H31N3O6S/c1-31(2,3)21-18-25(32-29(36)27(35)24-17-11-13-20-12-9-10-16-23(20)24)28(40-5)26(19-21)34(4)30(37)33-41(38,39)22-14-7-6-8-15-22/h6-19H,1-5H3,(H,32,36)(H,33,37) |
| InChIKey | OYUNESQUBLMDSY-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.67 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|