C27H28N2O4 — CID 67091404
N-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]-2-oxo-2-(2-phenylcyclopropyl)acetamide (PubChem CID 67091404) has the molecular formula C27H28N2O4 and a molecular weight of 444.53 g/mol. Its IUPAC name is N-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]-2-oxo-2-(2-phenylcyclopropyl)acetamide.
| Compound Name | N-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]-2-oxo-2-(2-phenylcyclopropyl)acetamide |
|---|---|
| PubChem CID | 67091404 |
| Molecular Formula | C27H28N2O4 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | N-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]-2-oxo-2-(2-phenylcyclopropyl)acetamide |
| SMILES | O=C(Nc1ccc(OCCN2CCOCC2)c2ccccc12)C(=O)C1CC1c1ccccc1 |
| InChI | InChI=1S/C27H28N2O4/c30-26(23-18-22(23)19-6-2-1-3-7-19)27(31)28-24-10-11-25(21-9-5-4-8-20(21)24)33-17-14-29-12-15-32-16-13-29/h1-11,22-23H,12-18H2,(H,28,31) |
| InChIKey | SBDSSRAZLALWLQ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|