C14H20N2O4 — CID 67094429
butyl 2-[(2-cyclopropyl-5-methyl-6-oxo-1H-pyrimidin-4-yl)oxy]acetate (PubChem CID 67094429) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is butyl 2-[(2-cyclopropyl-5-methyl-6-oxo-1H-pyrimidin-4-yl)oxy]acetate.
| Compound Name | butyl 2-[(2-cyclopropyl-5-methyl-6-oxo-1H-pyrimidin-4-yl)oxy]acetate |
|---|---|
| PubChem CID | 67094429 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | butyl 2-[(2-cyclopropyl-5-methyl-6-oxo-1H-pyrimidin-4-yl)oxy]acetate |
| SMILES | CCCCOC(=O)COc1nc(C2CC2)[nH]c(=O)c1C |
| InChI | InChI=1S/C14H20N2O4/c1-3-4-7-19-11(17)8-20-14-9(2)13(18)15-12(16-14)10-5-6-10/h10H,3-8H2,1-2H3,(H,15,16,18) |
| InChIKey | PRWABNFLYBHQGO-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|