C20H22N4O2S — CID 67101128
N-[3-(6-cyano-3-pyridinyl)-1-pentan-3-ylindol-6-yl]methanesulfonamide (PubChem CID 67101128) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is N-[3-(6-cyano-3-pyridinyl)-1-pentan-3-ylindol-6-yl]methanesulfonamide.
| Compound Name | N-[3-(6-cyano-3-pyridinyl)-1-pentan-3-ylindol-6-yl]methanesulfonamide |
|---|---|
| PubChem CID | 67101128 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | N-[3-(6-cyano-3-pyridinyl)-1-pentan-3-ylindol-6-yl]methanesulfonamide |
| SMILES | CCC(CC)n1cc(-c2ccc(C#N)nc2)c2ccc(NS(C)(=O)=O)cc21 |
| InChI | InChI=1S/C20H22N4O2S/c1-4-17(5-2)24-13-19(14-6-7-16(11-21)22-12-14)18-9-8-15(10-20(18)24)23-27(3,25)26/h6-10,12-13,17,23H,4-5H2,1-3H3 |
| InChIKey | VKVBCJUACOTXRC-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |