C17H17N3O2S2 — CID 67101494
N-[3-(5-cyanothiophen-3-yl)-1-propan-2-ylindol-6-yl]methanesulfonamide (PubChem CID 67101494) has the molecular formula C17H17N3O2S2 and a molecular weight of 359.48 g/mol. Its IUPAC name is N-[3-(5-cyanothiophen-3-yl)-1-propan-2-ylindol-6-yl]methanesulfonamide.
| Compound Name | N-[3-(5-cyanothiophen-3-yl)-1-propan-2-ylindol-6-yl]methanesulfonamide |
|---|---|
| PubChem CID | 67101494 |
| Molecular Formula | C17H17N3O2S2 |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | N-[3-(5-cyanothiophen-3-yl)-1-propan-2-ylindol-6-yl]methanesulfonamide |
| SMILES | CC(C)n1cc(-c2csc(C#N)c2)c2ccc(NS(C)(=O)=O)cc21 |
| InChI | InChI=1S/C17H17N3O2S2/c1-11(2)20-9-16(12-6-14(8-18)23-10-12)15-5-4-13(7-17(15)20)19-24(3,21)22/h4-7,9-11,19H,1-3H3 |
| InChIKey | MAODQPUJOJDPCP-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 74.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |