C21H22FN3O2S — CID 67101141
N-[3-(4-cyano-2-fluorophenyl)-1-[(2R)-3-methylbutan-2-yl]indol-6-yl]methanesulfonamide (PubChem CID 67101141) has the molecular formula C21H22FN3O2S and a molecular weight of 399.49 g/mol. Its IUPAC name is N-[3-(4-cyano-2-fluorophenyl)-1-[(2R)-3-methylbutan-2-yl]indol-6-yl]methanesulfonamide.
| Compound Name | N-[3-(4-cyano-2-fluorophenyl)-1-[(2R)-3-methylbutan-2-yl]indol-6-yl]methanesulfonamide |
|---|---|
| PubChem CID | 67101141 |
| Molecular Formula | C21H22FN3O2S |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | N-[3-(4-cyano-2-fluorophenyl)-1-[(2R)-3-methylbutan-2-yl]indol-6-yl]methanesulfonamide |
| SMILES | CC(C)[C@@H](C)n1cc(-c2ccc(C#N)cc2F)c2ccc(NS(C)(=O)=O)cc21 |
| InChI | InChI=1S/C21H22FN3O2S/c1-13(2)14(3)25-12-19(17-7-5-15(11-23)9-20(17)22)18-8-6-16(10-21(18)25)24-28(4,26)27/h5-10,12-14,24H,1-4H3/t14-/m1/s1 |
| InChIKey | VFXKJGRTIBWBPT-CQSZACIVSA-N |
| XLogP | 4.91 |
| TPSA | 74.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |