About N-[3-(4-cyano-3,5-difluorophenyl)-1-propan-2-ylindol-6-yl]methanesulfonamide
N-[3-(4-cyano-3,5-difluorophenyl)-1-propan-2-ylindol-6-yl]methanesulfonamide (PubChem CID 24739670) has the molecular formula C19H17F2N3O2S
and a molecular weight of 389.43 g/mol. Its IUPAC name is N-[3-(4-cyano-3,5-difluorophenyl)-1-propan-2-ylindol-6-yl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[3-(4-cyano-3,5-difluorophenyl)-1-propan-2-ylindol-6-yl]methanesulfonamide |
| PubChem CID | 24739670 |
| Molecular Formula | C19H17F2N3O2S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | N-[3-(4-cyano-3,5-difluorophenyl)-1-propan-2-ylindol-6-yl]methanesulfonamide |
| SMILES | CC(C)n1cc(-c2cc(F)c(C#N)c(F)c2)c2ccc(NS(C)(=O)=O)cc21 |
| InChI | InChI=1S/C19H17F2N3O2S/c1-11(2)24-10-16(12-6-17(20)15(9-22)18(21)7-12)14-5-4-13(8-19(14)24)23-27(3,25)26/h4-8,10-11,23H,1-3H3 |
| InChIKey | GIOKNSZNAYTPCN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 74.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[3-(4-cyano-3,5-difluorophenyl)-1-propan-2-ylindol-6-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(4-cyano-3,5-difluorophenyl)-1-propan-2-ylindol-6-yl]methanesulfonamide?
The IUPAC name of N-[3-(4-cyano-3,5-difluorophenyl)-1-propan-2-ylindol-6-yl]methanesulfonamide (CID 24739670) is N-[3-(4-cyano-3,5-difluorophenyl)-1-propan-2-ylindol-6-yl]methanesulfonamide.
What is the SMILES notation for N-[3-(4-cyano-3,5-difluorophenyl)-1-propan-2-ylindol-6-yl]methanesulfonamide?
The canonical SMILES for N-[3-(4-cyano-3,5-difluorophenyl)-1-propan-2-ylindol-6-yl]methanesulfonamide is CC(C)n1cc(-c2cc(F)c(C#N)c(F)c2)c2ccc(NS(C)(=O)=O)cc21.
What is the InChIKey of N-[3-(4-cyano-3,5-difluorophenyl)-1-propan-2-ylindol-6-yl]methanesulfonamide?
The InChIKey is GIOKNSZNAYTPCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17F2N3O2S/c1-11(2)24-10-16(12-6-17(20)15(9-22)18(21)7-12)14-5-4-13(8-19(14)24)23-27(3,25)26/h4-8,10-11,23H,1-3H3.
What are the key properties of N-[3-(4-cyano-3,5-difluorophenyl)-1-propan-2-ylindol-6-yl]methanesulfonamide?
N-[3-(4-cyano-3,5-difluorophenyl)-1-propan-2-ylindol-6-yl]methanesulfonamide has a molecular weight of 389.43 g/mol, XLogP of 4.41, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(4-cyano-3,5-difluorophenyl)-1-propan-2-ylindol-6-yl]methanesulfonamide is sourced from PubChem (CID 24739670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).