C23H23N3O2S — CID 57442256
N-[3-(4-cyanophenyl)-1-(dicyclopropylmethyl)indol-6-yl]methanesulfonamide (PubChem CID 57442256) has the molecular formula C23H23N3O2S and a molecular weight of 405.52 g/mol. Its IUPAC name is N-[3-(4-cyanophenyl)-1-(dicyclopropylmethyl)indol-6-yl]methanesulfonamide.
| Compound Name | N-[3-(4-cyanophenyl)-1-(dicyclopropylmethyl)indol-6-yl]methanesulfonamide |
|---|---|
| PubChem CID | 57442256 |
| Molecular Formula | C23H23N3O2S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | N-[3-(4-cyanophenyl)-1-(dicyclopropylmethyl)indol-6-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc2c(-c3ccc(C#N)cc3)cn(C(C3CC3)C3CC3)c2c1 |
| InChI | InChI=1S/C23H23N3O2S/c1-29(27,28)25-19-10-11-20-21(16-4-2-15(13-24)3-5-16)14-26(22(20)12-19)23(17-6-7-17)18-8-9-18/h2-5,10-12,14,17-18,23,25H,6-9H2,1H3 |
| InChIKey | WRVQNZJULPTSAV-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 74.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |