C12H17O7PS2 — CID 67103231
2-[(3-dimethoxyphosphorylsulfanyl-4-methoxyphenyl)methylsulfinyl]acetic acid (PubChem CID 67103231) has the molecular formula C12H17O7PS2 and a molecular weight of 368.37 g/mol. Its IUPAC name is 2-[(3-dimethoxyphosphorylsulfanyl-4-methoxyphenyl)methylsulfinyl]acetic acid.
| Compound Name | 2-[(3-dimethoxyphosphorylsulfanyl-4-methoxyphenyl)methylsulfinyl]acetic acid |
|---|---|
| PubChem CID | 67103231 |
| Molecular Formula | C12H17O7PS2 |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | 2-[(3-dimethoxyphosphorylsulfanyl-4-methoxyphenyl)methylsulfinyl]acetic acid |
| SMILES | COc1ccc(CS(=O)CC(=O)O)cc1SP(=O)(OC)OC |
| InChI | InChI=1S/C12H17O7PS2/c1-17-10-5-4-9(7-22(16)8-12(13)14)6-11(10)21-20(15,18-2)19-3/h4-6H,7-8H2,1-3H3,(H,13,14) |
| InChIKey | IDGJHLWMGBYUFV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|