C14H20F3N3O2 — CID 67112037
tert-butyl 4-[5-(trifluoromethyl)-1H-imidazol-2-yl]piperidine-1-carboxylate (PubChem CID 67112037) has the molecular formula C14H20F3N3O2 and a molecular weight of 319.33 g/mol. Its IUPAC name is tert-butyl 4-[5-(trifluoromethyl)-1H-imidazol-2-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-(trifluoromethyl)-1H-imidazol-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67112037 |
| Molecular Formula | C14H20F3N3O2 |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | tert-butyl 4-[5-(trifluoromethyl)-1H-imidazol-2-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ncc(C(F)(F)F)[nH]2)CC1 |
| InChI | InChI=1S/C14H20F3N3O2/c1-13(2,3)22-12(21)20-6-4-9(5-7-20)11-18-8-10(19-11)14(15,16)17/h8-9H,4-7H2,1-3H3,(H,18,19) |
| InChIKey | NPRGUNRKTVHJKC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |