C12H25N4O7P2Pt- — CID 6711764
(2-azanidylcyclohexyl)azanide;hydroxy-(1-nitroso-2-phosphonoazepan-2-yl)phosphinate;platinum(2+) (PubChem CID 6711764) has the molecular formula C12H25N4O7P2Pt- and a molecular weight of 594.38 g/mol. Its IUPAC name is (2-azanidylcyclohexyl)azanide;hydroxy-(1-nitroso-2-phosphonoazepan-2-yl)phosphinate;platinum(2+).
| Compound Name | (2-azanidylcyclohexyl)azanide;hydroxy-(1-nitroso-2-phosphonoazepan-2-yl)phosphinate;platinum(2+) |
|---|---|
| PubChem CID | 6711764 |
| Molecular Formula | C12H25N4O7P2Pt- |
| Molecular Weight | 594.38 g/mol |
| Exact Mass | 594.09 |
| IUPAC Name | (2-azanidylcyclohexyl)azanide;hydroxy-(1-nitroso-2-phosphonoazepan-2-yl)phosphinate;platinum(2+) |
| SMILES | O=NN1CCCCCC1(P(=O)([O-])O)P(=O)(O)O.[NH-]C1CCCCC1[NH-].[Pt+2] |
| InChI | InChI=1S/C6H14N2O7P2.C6H12N2.Pt/c9-7-8-5-3-1-2-4-6(8,16(10,11)12)17(13,14)15;7-5-3-1-2-4-6(5)8;/h1-5H2,(H2,10,11,12)(H2,13,14,15);5-8H,1-4H2;/q;-2;+2/p-1 |
| InChIKey | KBIRJZGRRWUGET-UHFFFAOYSA-M |
| XLogP | 2.32 |
| TPSA | 198.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|