C28H42N4O9 — CID 67122748
4-[[[[(2S)-2-amino-2-[(2-methylpropan-2-yl)oxycarbonyl]-4-oxo-4-phenylmethoxybutanoyl]amino]-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]piperidine-1-carboxylic acid (PubChem CID 67122748) has the molecular formula C28H42N4O9 and a molecular weight of 578.66 g/mol. Its IUPAC name is 4-[[[[(2S)-2-amino-2-[(2-methylpropan-2-yl)oxycarbonyl]-4-oxo-4-phenylmethoxybutanoyl]amino]-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]piperidine-1-carboxylic acid.
| Compound Name | 4-[[[[(2S)-2-amino-2-[(2-methylpropan-2-yl)oxycarbonyl]-4-oxo-4-phenylmethoxybutanoyl]amino]-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 67122748 |
| Molecular Formula | C28H42N4O9 |
| Molecular Weight | 578.66 g/mol |
| Exact Mass | 578.30 |
| IUPAC Name | 4-[[[[(2S)-2-amino-2-[(2-methylpropan-2-yl)oxycarbonyl]-4-oxo-4-phenylmethoxybutanoyl]amino]-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]piperidine-1-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N(CC1CCN(C(=O)O)CC1)NC(=O)[C@@](N)(CC(=O)OCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H42N4O9/c1-26(2,3)40-23(35)28(29,16-21(33)39-18-20-10-8-7-9-11-20)22(34)30-32(25(38)41-27(4,5)6)17-19-12-14-31(15-13-19)24(36)37/h7-11,19H,12-18,29H2,1-6H3,(H,30,34)(H,36,37)/t28-/m0/s1 |
| InChIKey | BCVHCCZXFYLKLH-NDEPHWFRSA-N |
| XLogP | 2.82 |
| TPSA | 177.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.66 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|