C19H19Cl2N3O — CID 67123395
(6S,7R)-7-(3,4-dichlorophenyl)-6-(indazol-1-ylmethyl)-1,4-oxazepane (PubChem CID 67123395) has the molecular formula C19H19Cl2N3O and a molecular weight of 376.29 g/mol. Its IUPAC name is (6S,7R)-7-(3,4-dichlorophenyl)-6-(indazol-1-ylmethyl)-1,4-oxazepane.
| Compound Name | (6S,7R)-7-(3,4-dichlorophenyl)-6-(indazol-1-ylmethyl)-1,4-oxazepane |
|---|---|
| PubChem CID | 67123395 |
| Molecular Formula | C19H19Cl2N3O |
| Molecular Weight | 376.29 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | (6S,7R)-7-(3,4-dichlorophenyl)-6-(indazol-1-ylmethyl)-1,4-oxazepane |
| SMILES | Clc1ccc([C@@H]2OCCNC[C@H]2Cn2ncc3ccccc32)cc1Cl |
| InChI | InChI=1S/C19H19Cl2N3O/c20-16-6-5-13(9-17(16)21)19-15(10-22-7-8-25-19)12-24-18-4-2-1-3-14(18)11-23-24/h1-6,9,11,15,19,22H,7-8,10,12H2/t15-,19-/m0/s1 |
| InChIKey | YCAIARQFLYITQP-KXBFYZLASA-N |
| XLogP | 4.32 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.29 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |