C15H16Cl2N2OS — CID 67123388
(6R,7R)-7-(3,4-dichlorophenyl)-6-(1,3-thiazol-2-ylmethyl)-1,4-oxazepane (PubChem CID 67123388) has the molecular formula C15H16Cl2N2OS and a molecular weight of 343.28 g/mol. Its IUPAC name is (6R,7R)-7-(3,4-dichlorophenyl)-6-(1,3-thiazol-2-ylmethyl)-1,4-oxazepane.
| Compound Name | (6R,7R)-7-(3,4-dichlorophenyl)-6-(1,3-thiazol-2-ylmethyl)-1,4-oxazepane |
|---|---|
| PubChem CID | 67123388 |
| Molecular Formula | C15H16Cl2N2OS |
| Molecular Weight | 343.28 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | (6R,7R)-7-(3,4-dichlorophenyl)-6-(1,3-thiazol-2-ylmethyl)-1,4-oxazepane |
| SMILES | Clc1ccc([C@@H]2OCCNC[C@H]2Cc2nccs2)cc1Cl |
| InChI | InChI=1S/C15H16Cl2N2OS/c16-12-2-1-10(7-13(12)17)15-11(9-18-3-5-20-15)8-14-19-4-6-21-14/h1-2,4,6-7,11,15,18H,3,5,8-9H2/t11-,15+/m1/s1 |
| InChIKey | HVKZVUVBXQMWFA-ABAIWWIYSA-N |
| XLogP | 3.97 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.28 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |