C14H17Cl2NO2 — CID 67128440
1-pyrrolidin-1-ylethyl 2-(3,4-dichlorophenyl)acetate (PubChem CID 67128440) has the molecular formula C14H17Cl2NO2 and a molecular weight of 302.20 g/mol. Its IUPAC name is 1-pyrrolidin-1-ylethyl 2-(3,4-dichlorophenyl)acetate.
| Compound Name | 1-pyrrolidin-1-ylethyl 2-(3,4-dichlorophenyl)acetate |
|---|---|
| PubChem CID | 67128440 |
| Molecular Formula | C14H17Cl2NO2 |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 1-pyrrolidin-1-ylethyl 2-(3,4-dichlorophenyl)acetate |
| SMILES | CC(OC(=O)Cc1ccc(Cl)c(Cl)c1)N1CCCC1 |
| InChI | InChI=1S/C14H17Cl2NO2/c1-10(17-6-2-3-7-17)19-14(18)9-11-4-5-12(15)13(16)8-11/h4-5,8,10H,2-3,6-7,9H2,1H3 |
| InChIKey | KAJCBMQYEBTMPP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |