C22H33ClN6O4 — CID 67131863
4-[3-[2-[[3-(4-carbamimidoylphenoxy)-2-hydroxypropyl]amino]ethylamino]-2-hydroxypropoxy]benzenecarboximidamide;hydrochloride (PubChem CID 67131863) has the molecular formula C22H33ClN6O4 and a molecular weight of 481.00 g/mol. Its IUPAC name is 4-[3-[2-[[3-(4-carbamimidoylphenoxy)-2-hydroxypropyl]amino]ethylamino]-2-hydroxypropoxy]benzenecarboximidamide;hydrochloride.
| Compound Name | 4-[3-[2-[[3-(4-carbamimidoylphenoxy)-2-hydroxypropyl]amino]ethylamino]-2-hydroxypropoxy]benzenecarboximidamide;hydrochloride |
|---|---|
| PubChem CID | 67131863 |
| Molecular Formula | C22H33ClN6O4 |
| Molecular Weight | 481.00 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | 4-[3-[2-[[3-(4-carbamimidoylphenoxy)-2-hydroxypropyl]amino]ethylamino]-2-hydroxypropoxy]benzenecarboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(OCC(O)CNCCNCC(O)COc2ccc(/C(N)=N/[H])cc2)cc1 |
| InChI | InChI=1S/C22H32N6O4.ClH/c23-21(24)15-1-5-19(6-2-15)31-13-17(29)11-27-9-10-28-12-18(30)14-32-20-7-3-16(4-8-20)22(25)26;/h1-8,17-18,27-30H,9-14H2,(H3,23,24)(H3,25,26);1H |
| InChIKey | RUJXOXDSFSSEFC-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 182.72 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.00 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|