C14H16F3N3O3 — CID 67136682
(2-amino-2-oxoethyl)-[[1-[3-(trifluoromethyl)phenyl]azetidin-3-yl]methyl]carbamic acid (PubChem CID 67136682) has the molecular formula C14H16F3N3O3 and a molecular weight of 331.29 g/mol. Its IUPAC name is (2-amino-2-oxoethyl)-[[1-[3-(trifluoromethyl)phenyl]azetidin-3-yl]methyl]carbamic acid.
| Compound Name | (2-amino-2-oxoethyl)-[[1-[3-(trifluoromethyl)phenyl]azetidin-3-yl]methyl]carbamic acid |
|---|---|
| PubChem CID | 67136682 |
| Molecular Formula | C14H16F3N3O3 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | (2-amino-2-oxoethyl)-[[1-[3-(trifluoromethyl)phenyl]azetidin-3-yl]methyl]carbamic acid |
| SMILES | NC(=O)CN(CC1CN(c2cccc(C(F)(F)F)c2)C1)C(=O)O |
| InChI | InChI=1S/C14H16F3N3O3/c15-14(16,17)10-2-1-3-11(4-10)19-5-9(6-19)7-20(13(22)23)8-12(18)21/h1-4,9H,5-8H2,(H2,18,21)(H,22,23) |
| InChIKey | XJXIPWFESIKHJL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |