C30H36F3N3O5 — CID 67136764
[2,6-ditert-butyl-4-[2-[5-ethoxy-3-imino-6-(methylcarbamoyl)-1H-isoindol-2-yl]acetyl]phenyl] 2,2,2-trifluoroacetate (PubChem CID 67136764) has the molecular formula C30H36F3N3O5 and a molecular weight of 575.63 g/mol. Its IUPAC name is [2,6-ditert-butyl-4-[2-[5-ethoxy-3-imino-6-(methylcarbamoyl)-1H-isoindol-2-yl]acetyl]phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [2,6-ditert-butyl-4-[2-[5-ethoxy-3-imino-6-(methylcarbamoyl)-1H-isoindol-2-yl]acetyl]phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 67136764 |
| Molecular Formula | C30H36F3N3O5 |
| Molecular Weight | 575.63 g/mol |
| Exact Mass | 575.26 |
| IUPAC Name | [2,6-ditert-butyl-4-[2-[5-ethoxy-3-imino-6-(methylcarbamoyl)-1H-isoindol-2-yl]acetyl]phenyl] 2,2,2-trifluoroacetate |
| SMILES | [H]/N=C1/c2cc(OCC)c(C(=O)NC)cc2CN1CC(=O)c1cc(C(C)(C)C)c(OC(=O)C(F)(F)F)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C30H36F3N3O5/c1-9-40-23-13-18-17(10-19(23)26(38)35-8)14-36(25(18)34)15-22(37)16-11-20(28(2,3)4)24(21(12-16)29(5,6)7)41-27(39)30(31,32)33/h10-13,34H,9,14-15H2,1-8H3,(H,35,38)/b34-25- |
| InChIKey | MKROZPNBPKOPGK-NQUVTRGKSA-N |
| XLogP | 5.53 |
| TPSA | 108.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.63 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|