C30H30F3N3O7 — CID 87284292
(2,2,2-trifluoroacetyl) 7-tert-butyl-5-[2-[6-ethoxy-3-imino-5-(methylcarbamoyl)-1H-isoindol-2-yl]acetyl]-2-methyl-1-benzofuran-3-carboxylate (PubChem CID 87284292) has the molecular formula C30H30F3N3O7 and a molecular weight of 601.58 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 7-tert-butyl-5-[2-[6-ethoxy-3-imino-5-(methylcarbamoyl)-1H-isoindol-2-yl]acetyl]-2-methyl-1-benzofuran-3-carboxylate.
| Compound Name | (2,2,2-trifluoroacetyl) 7-tert-butyl-5-[2-[6-ethoxy-3-imino-5-(methylcarbamoyl)-1H-isoindol-2-yl]acetyl]-2-methyl-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 87284292 |
| Molecular Formula | C30H30F3N3O7 |
| Molecular Weight | 601.58 g/mol |
| Exact Mass | 601.20 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 7-tert-butyl-5-[2-[6-ethoxy-3-imino-5-(methylcarbamoyl)-1H-isoindol-2-yl]acetyl]-2-methyl-1-benzofuran-3-carboxylate |
| SMILES | [H]/N=C1\c2cc(C(=O)NC)c(OCC)cc2CN1CC(=O)c1cc(C(C)(C)C)c2oc(C)c(C(=O)OC(=O)C(F)(F)F)c2c1 |
| InChI | InChI=1S/C30H30F3N3O7/c1-7-41-22-10-16-12-36(25(34)17(16)11-18(22)26(38)35-6)13-21(37)15-8-19-23(27(39)43-28(40)30(31,32)33)14(2)42-24(19)20(9-15)29(3,4)5/h8-11,34H,7,12-13H2,1-6H3,(H,35,38)/b34-25+ |
| InChIKey | SKIIDBLBMYYSIW-YQCHCMBFSA-N |
| XLogP | 5.07 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.58 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|