C25H26N4O — CID 67152171
(1R)-1-[1-[3-(2-piperazin-1-ylphenyl)phenyl]benzimidazol-5-yl]ethanol (PubChem CID 67152171) has the molecular formula C25H26N4O and a molecular weight of 398.51 g/mol. Its IUPAC name is (1R)-1-[1-[3-(2-piperazin-1-ylphenyl)phenyl]benzimidazol-5-yl]ethanol.
| Compound Name | (1R)-1-[1-[3-(2-piperazin-1-ylphenyl)phenyl]benzimidazol-5-yl]ethanol |
|---|---|
| PubChem CID | 67152171 |
| Molecular Formula | C25H26N4O |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | (1R)-1-[1-[3-(2-piperazin-1-ylphenyl)phenyl]benzimidazol-5-yl]ethanol |
| SMILES | C[C@@H](O)c1ccc2c(c1)ncn2-c1cccc(-c2ccccc2N2CCNCC2)c1 |
| InChI | InChI=1S/C25H26N4O/c1-18(30)19-9-10-25-23(16-19)27-17-29(25)21-6-4-5-20(15-21)22-7-2-3-8-24(22)28-13-11-26-12-14-28/h2-10,15-18,26,30H,11-14H2,1H3/t18-/m1/s1 |
| InChIKey | YFQSORCGYDGRRB-GOSISDBHSA-N |
| XLogP | 4.16 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |