C26H27N3O2 — CID 67152234
(1R)-1-[1-[3-[2-(morpholin-4-ylmethyl)phenyl]phenyl]benzimidazol-5-yl]ethanol (PubChem CID 67152234) has the molecular formula C26H27N3O2 and a molecular weight of 413.52 g/mol. Its IUPAC name is (1R)-1-[1-[3-[2-(morpholin-4-ylmethyl)phenyl]phenyl]benzimidazol-5-yl]ethanol.
| Compound Name | (1R)-1-[1-[3-[2-(morpholin-4-ylmethyl)phenyl]phenyl]benzimidazol-5-yl]ethanol |
|---|---|
| PubChem CID | 67152234 |
| Molecular Formula | C26H27N3O2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | (1R)-1-[1-[3-[2-(morpholin-4-ylmethyl)phenyl]phenyl]benzimidazol-5-yl]ethanol |
| SMILES | C[C@@H](O)c1ccc2c(c1)ncn2-c1cccc(-c2ccccc2CN2CCOCC2)c1 |
| InChI | InChI=1S/C26H27N3O2/c1-19(30)20-9-10-26-25(16-20)27-18-29(26)23-7-4-6-21(15-23)24-8-3-2-5-22(24)17-28-11-13-31-14-12-28/h2-10,15-16,18-19,30H,11-14,17H2,1H3/t19-/m1/s1 |
| InChIKey | LFDSUBZCQOTKHT-LJQANCHMSA-N |
| XLogP | 4.58 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |