C25H25N5O2 — CID 87288110
N'-hydroxy-1-[3-[2-(morpholin-4-ylmethyl)phenyl]phenyl]benzimidazole-5-carboximidamide (PubChem CID 87288110) has the molecular formula C25H25N5O2 and a molecular weight of 427.51 g/mol. Its IUPAC name is N'-hydroxy-1-[3-[2-(morpholin-4-ylmethyl)phenyl]phenyl]benzimidazole-5-carboximidamide.
| Compound Name | N'-hydroxy-1-[3-[2-(morpholin-4-ylmethyl)phenyl]phenyl]benzimidazole-5-carboximidamide |
|---|---|
| PubChem CID | 87288110 |
| Molecular Formula | C25H25N5O2 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | N'-hydroxy-1-[3-[2-(morpholin-4-ylmethyl)phenyl]phenyl]benzimidazole-5-carboximidamide |
| SMILES | N/C(=N\O)c1ccc2c(c1)ncn2-c1cccc(-c2ccccc2CN2CCOCC2)c1 |
| InChI | InChI=1S/C25H25N5O2/c26-25(28-31)19-8-9-24-23(15-19)27-17-30(24)21-6-3-5-18(14-21)22-7-2-1-4-20(22)16-29-10-12-32-13-11-29/h1-9,14-15,17,31H,10-13,16H2,(H2,26,28) |
| InChIKey | NDMGYBPJVDKCBF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 88.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|