C23H23N5O2 — CID 67152175
(1R)-1-[1-[3-(2-morpholin-4-ylpyrimidin-5-yl)phenyl]benzimidazol-5-yl]ethanol (PubChem CID 67152175) has the molecular formula C23H23N5O2 and a molecular weight of 401.47 g/mol. Its IUPAC name is (1R)-1-[1-[3-(2-morpholin-4-ylpyrimidin-5-yl)phenyl]benzimidazol-5-yl]ethanol.
| Compound Name | (1R)-1-[1-[3-(2-morpholin-4-ylpyrimidin-5-yl)phenyl]benzimidazol-5-yl]ethanol |
|---|---|
| PubChem CID | 67152175 |
| Molecular Formula | C23H23N5O2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | (1R)-1-[1-[3-(2-morpholin-4-ylpyrimidin-5-yl)phenyl]benzimidazol-5-yl]ethanol |
| SMILES | C[C@@H](O)c1ccc2c(c1)ncn2-c1cccc(-c2cnc(N3CCOCC3)nc2)c1 |
| InChI | InChI=1S/C23H23N5O2/c1-16(29)17-5-6-22-21(12-17)26-15-28(22)20-4-2-3-18(11-20)19-13-24-23(25-14-19)27-7-9-30-10-8-27/h2-6,11-16,29H,7-10H2,1H3/t16-/m1/s1 |
| InChIKey | PKLHUYICFFLWSN-MRXNPFEDSA-N |
| XLogP | 3.37 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |