C24H28ClN7 — CID 67161649
3-[[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ylidene]methyl]-4-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2H-pyrazolo[3,4-d]pyrimidine (PubChem CID 67161649) has the molecular formula C24H28ClN7 and a molecular weight of 449.99 g/mol. Its IUPAC name is 3-[[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ylidene]methyl]-4-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2H-pyrazolo[3,4-d]pyrimidine.
| Compound Name | 3-[[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ylidene]methyl]-4-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2H-pyrazolo[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 67161649 |
| Molecular Formula | C24H28ClN7 |
| Molecular Weight | 449.99 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 3-[[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ylidene]methyl]-4-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2H-pyrazolo[3,4-d]pyrimidine |
| SMILES | Cc1ccc(Cl)cc1N1CCN(c2ncnc3n[nH]c(/C=C4/C[C@H]5CNC[C@H]5C4)c23)CC1 |
| InChI | InChI=1S/C24H28ClN7/c1-15-2-3-19(25)11-21(15)31-4-6-32(7-5-31)24-22-20(29-30-23(22)27-14-28-24)10-16-8-17-12-26-13-18(17)9-16/h2-3,10-11,14,17-18,26H,4-9,12-13H2,1H3,(H,27,28,29,30)/b16-10-/t17-,18+/m0/s1 |
| InChIKey | XGTZCWKAKMYRKM-ARLDCUANSA-N |
| XLogP | 3.65 |
| TPSA | 72.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.99 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |