C23H27ClN6O2 — CID 67163119
tert-butyl (E)-3-[4-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2H-pyrazolo[3,4-d]pyrimidin-3-yl]prop-2-enoate (PubChem CID 67163119) has the molecular formula C23H27ClN6O2 and a molecular weight of 454.96 g/mol. Its IUPAC name is tert-butyl (E)-3-[4-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2H-pyrazolo[3,4-d]pyrimidin-3-yl]prop-2-enoate.
| Compound Name | tert-butyl (E)-3-[4-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2H-pyrazolo[3,4-d]pyrimidin-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 67163119 |
| Molecular Formula | C23H27ClN6O2 |
| Molecular Weight | 454.96 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | tert-butyl (E)-3-[4-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2H-pyrazolo[3,4-d]pyrimidin-3-yl]prop-2-enoate |
| SMILES | Cc1ccc(Cl)cc1N1CCN(c2ncnc3n[nH]c(/C=C/C(=O)OC(C)(C)C)c23)CC1 |
| InChI | InChI=1S/C23H27ClN6O2/c1-15-5-6-16(24)13-18(15)29-9-11-30(12-10-29)22-20-17(27-28-21(20)25-14-26-22)7-8-19(31)32-23(2,3)4/h5-8,13-14H,9-12H2,1-4H3,(H,25,26,27,28)/b8-7+ |
| InChIKey | AZHZHOLJFMHYBJ-BQYQJAHWSA-N |
| XLogP | 4.00 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.96 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|