C26H23F3N8O2S — CID 67162606
6-(3-methylsulfonylphenyl)-8-[(1R)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]-4-N-(2,2,2-trifluoroethyl)pyrido[3,2-d]pyrimidine-2,4-diamine (PubChem CID 67162606) has the molecular formula C26H23F3N8O2S and a molecular weight of 568.59 g/mol. Its IUPAC name is 6-(3-methylsulfonylphenyl)-8-[(1R)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]-4-N-(2,2,2-trifluoroethyl)pyrido[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 6-(3-methylsulfonylphenyl)-8-[(1R)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]-4-N-(2,2,2-trifluoroethyl)pyrido[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 67162606 |
| Molecular Formula | C26H23F3N8O2S |
| Molecular Weight | 568.59 g/mol |
| Exact Mass | 568.16 |
| IUPAC Name | 6-(3-methylsulfonylphenyl)-8-[(1R)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]-4-N-(2,2,2-trifluoroethyl)pyrido[3,2-d]pyrimidine-2,4-diamine |
| SMILES | C[C@H](c1ccc(-n2cncn2)cc1)c1cc(-c2cccc(S(C)(=O)=O)c2)nc2c(NCC(F)(F)F)nc(N)nc12 |
| InChI | InChI=1S/C26H23F3N8O2S/c1-15(16-6-8-18(9-7-16)37-14-31-13-33-37)20-11-21(17-4-3-5-19(10-17)40(2,38)39)34-23-22(20)35-25(30)36-24(23)32-12-26(27,28)29/h3-11,13-15H,12H2,1-2H3,(H3,30,32,35,36)/t15-/m1/s1 |
| InChIKey | OFVRZQOHMAGSFO-OAHLLOKOSA-N |
| XLogP | 4.38 |
| TPSA | 141.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.59 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |