C20H18N4O2S — CID 8814679
N-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]naphthalene-2-sulfonamide (PubChem CID 8814679) has the molecular formula C20H18N4O2S and a molecular weight of 378.46 g/mol. Its IUPAC name is N-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]naphthalene-2-sulfonamide.
| Compound Name | N-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 8814679 |
| Molecular Formula | C20H18N4O2S |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | N-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]naphthalene-2-sulfonamide |
| SMILES | C[C@H](NS(=O)(=O)c1ccc2ccccc2c1)c1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C20H18N4O2S/c1-15(16-6-9-19(10-7-16)24-14-21-13-22-24)23-27(25,26)20-11-8-17-4-2-3-5-18(17)12-20/h2-15,23H,1H3/t15-/m0/s1 |
| InChIKey | LGCONTXGEMCWGD-HNNXBMFYSA-N |
| XLogP | 3.46 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |