C16H13F3N4O2S — CID 84843192
2,3,4-trifluoro-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]benzenesulfonamide (PubChem CID 84843192) has the molecular formula C16H13F3N4O2S and a molecular weight of 382.37 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]benzenesulfonamide.
| Compound Name | 2,3,4-trifluoro-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 84843192 |
| Molecular Formula | C16H13F3N4O2S |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 2,3,4-trifluoro-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]benzenesulfonamide |
| SMILES | CC(NS(=O)(=O)c1ccc(F)c(F)c1F)c1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C16H13F3N4O2S/c1-10(11-2-4-12(5-3-11)23-9-20-8-21-23)22-26(24,25)14-7-6-13(17)15(18)16(14)19/h2-10,22H,1H3 |
| InChIKey | PKLZKWWOBYXTDY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|