C21H26N4O2S — CID 8815199
2,3,4,5,6-pentamethyl-N-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]benzenesulfonamide (PubChem CID 8815199) has the molecular formula C21H26N4O2S and a molecular weight of 398.53 g/mol. Its IUPAC name is 2,3,4,5,6-pentamethyl-N-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]benzenesulfonamide.
| Compound Name | 2,3,4,5,6-pentamethyl-N-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 8815199 |
| Molecular Formula | C21H26N4O2S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 2,3,4,5,6-pentamethyl-N-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]benzenesulfonamide |
| SMILES | Cc1c(C)c(C)c(S(=O)(=O)N[C@@H](C)c2ccc(-n3cncn3)cc2)c(C)c1C |
| InChI | InChI=1S/C21H26N4O2S/c1-13-14(2)16(4)21(17(5)15(13)3)28(26,27)24-18(6)19-7-9-20(10-8-19)25-12-22-11-23-25/h7-12,18,24H,1-6H3/t18-/m0/s1 |
| InChIKey | KTYMHIUMDZPJGP-SFHVURJKSA-N |
| XLogP | 3.85 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |