C20H23NO2S — CID 67166617
2-[(2E)-2-[3-(dimethylamino)propylidene]-4-thiatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),5,11,13-pentaen-13-yl]acetic acid (PubChem CID 67166617) has the molecular formula C20H23NO2S and a molecular weight of 341.48 g/mol. Its IUPAC name is 2-[(2E)-2-[3-(dimethylamino)propylidene]-4-thiatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),5,11,13-pentaen-13-yl]acetic acid.
| Compound Name | 2-[(2E)-2-[3-(dimethylamino)propylidene]-4-thiatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),5,11,13-pentaen-13-yl]acetic acid |
|---|---|
| PubChem CID | 67166617 |
| Molecular Formula | C20H23NO2S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 2-[(2E)-2-[3-(dimethylamino)propylidene]-4-thiatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),5,11,13-pentaen-13-yl]acetic acid |
| SMILES | CN(C)CC/C=C1\c2cc(CC(=O)O)ccc2CCc2ccsc21 |
| InChI | InChI=1S/C20H23NO2S/c1-21(2)10-3-4-17-18-12-14(13-19(22)23)5-6-15(18)7-8-16-9-11-24-20(16)17/h4-6,9,11-12H,3,7-8,10,13H2,1-2H3,(H,22,23)/b17-4+ |
| InChIKey | XLTUJCLFBFAFED-HAVNEIBRSA-N |
| XLogP | 3.86 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |