C22H25NO3S — CID 67168573
ethyl (E)-3-[(10Z)-10-[3-(dimethylamino)propylidene]-4H-thieno[3,2-c][1]benzoxepin-8-yl]prop-2-enoate (PubChem CID 67168573) has the molecular formula C22H25NO3S and a molecular weight of 383.51 g/mol. Its IUPAC name is ethyl (E)-3-[(10Z)-10-[3-(dimethylamino)propylidene]-4H-thieno[3,2-c][1]benzoxepin-8-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(10Z)-10-[3-(dimethylamino)propylidene]-4H-thieno[3,2-c][1]benzoxepin-8-yl]prop-2-enoate |
|---|---|
| PubChem CID | 67168573 |
| Molecular Formula | C22H25NO3S |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | ethyl (E)-3-[(10Z)-10-[3-(dimethylamino)propylidene]-4H-thieno[3,2-c][1]benzoxepin-8-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc2c(c1)/C(=C/CCN(C)C)c1sccc1CO2 |
| InChI | InChI=1S/C22H25NO3S/c1-4-25-21(24)10-8-16-7-9-20-19(14-16)18(6-5-12-23(2)3)22-17(15-26-20)11-13-27-22/h6-11,13-14H,4-5,12,15H2,1-3H3/b10-8+,18-6- |
| InChIKey | XTBUXZJUUJSZOW-MZYYCJCJSA-N |
| XLogP | 4.60 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|