C28H26N2O2 — CID 67170875
2-[1,2-bis(4-methoxyphenyl)ethenyl]-1,1-diphenylhydrazine (PubChem CID 67170875) has the molecular formula C28H26N2O2 and a molecular weight of 422.53 g/mol. Its IUPAC name is 2-[1,2-bis(4-methoxyphenyl)ethenyl]-1,1-diphenylhydrazine.
| Compound Name | 2-[1,2-bis(4-methoxyphenyl)ethenyl]-1,1-diphenylhydrazine |
|---|---|
| PubChem CID | 67170875 |
| Molecular Formula | C28H26N2O2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 2-[1,2-bis(4-methoxyphenyl)ethenyl]-1,1-diphenylhydrazine |
| SMILES | COc1ccc(C=C(NN(c2ccccc2)c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C28H26N2O2/c1-31-26-17-13-22(14-18-26)21-28(23-15-19-27(32-2)20-16-23)29-30(24-9-5-3-6-10-24)25-11-7-4-8-12-25/h3-21,29H,1-2H3 |
| InChIKey | IVSUXDHWORJMTD-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|