C17H25NO6 — CID 67172904
2-[(1R,5R,6R)-3-methyl-6-[[[(1S)-1-propanoyloxyethoxy]carbonylamino]methyl]-6-bicyclo[3.2.0]hept-3-enyl]acetic acid (PubChem CID 67172904) has the molecular formula C17H25NO6 and a molecular weight of 339.39 g/mol. Its IUPAC name is 2-[(1R,5R,6R)-3-methyl-6-[[[(1S)-1-propanoyloxyethoxy]carbonylamino]methyl]-6-bicyclo[3.2.0]hept-3-enyl]acetic acid.
| Compound Name | 2-[(1R,5R,6R)-3-methyl-6-[[[(1S)-1-propanoyloxyethoxy]carbonylamino]methyl]-6-bicyclo[3.2.0]hept-3-enyl]acetic acid |
|---|---|
| PubChem CID | 67172904 |
| Molecular Formula | C17H25NO6 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 2-[(1R,5R,6R)-3-methyl-6-[[[(1S)-1-propanoyloxyethoxy]carbonylamino]methyl]-6-bicyclo[3.2.0]hept-3-enyl]acetic acid |
| SMILES | CCC(=O)O[C@H](C)OC(=O)NC[C@@]1(CC(=O)O)C[C@H]2CC(C)=C[C@@H]21 |
| InChI | InChI=1S/C17H25NO6/c1-4-15(21)23-11(3)24-16(22)18-9-17(8-14(19)20)7-12-5-10(2)6-13(12)17/h6,11-13H,4-5,7-9H2,1-3H3,(H,18,22)(H,19,20)/t11-,12+,13-,17-/m0/s1 |
| InChIKey | AYULBPOIHDUNLZ-LKQDWFRTSA-N |
| XLogP | 2.46 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|