C28H31N3O4S — CID 67185760
2-[1-benzothiophen-3-ylmethyl-[[4-(3-octyl-1,2,4-oxadiazol-5-yl)phenyl]methyl]amino]-2-oxoacetic acid (PubChem CID 67185760) has the molecular formula C28H31N3O4S and a molecular weight of 505.64 g/mol. Its IUPAC name is 2-[1-benzothiophen-3-ylmethyl-[[4-(3-octyl-1,2,4-oxadiazol-5-yl)phenyl]methyl]amino]-2-oxoacetic acid.
| Compound Name | 2-[1-benzothiophen-3-ylmethyl-[[4-(3-octyl-1,2,4-oxadiazol-5-yl)phenyl]methyl]amino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 67185760 |
| Molecular Formula | C28H31N3O4S |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | 2-[1-benzothiophen-3-ylmethyl-[[4-(3-octyl-1,2,4-oxadiazol-5-yl)phenyl]methyl]amino]-2-oxoacetic acid |
| SMILES | CCCCCCCCc1noc(-c2ccc(CN(Cc3csc4ccccc34)C(=O)C(=O)O)cc2)n1 |
| InChI | InChI=1S/C28H31N3O4S/c1-2-3-4-5-6-7-12-25-29-26(35-30-25)21-15-13-20(14-16-21)17-31(27(32)28(33)34)18-22-19-36-24-11-9-8-10-23(22)24/h8-11,13-16,19H,2-7,12,17-18H2,1H3,(H,33,34) |
| InChIKey | OYZKGECBPALYOL-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|