About methyl 4-[(4-morpholin-4-yl-2,3-dihydro-1H-inden-1-yl)carbamoylamino]indazole-1-carboxylate
methyl 4-[(4-morpholin-4-yl-2,3-dihydro-1H-inden-1-yl)carbamoylamino]indazole-1-carboxylate (PubChem CID 67189904) has the molecular formula C23H25N5O4
and a molecular weight of 435.48 g/mol. Its IUPAC name is methyl 4-[(4-morpholin-4-yl-2,3-dihydro-1H-inden-1-yl)carbamoylamino]indazole-1-carboxylate.
Molecular Properties
| Compound Name | methyl 4-[(4-morpholin-4-yl-2,3-dihydro-1H-inden-1-yl)carbamoylamino]indazole-1-carboxylate |
| PubChem CID | 67189904 |
| Molecular Formula | C23H25N5O4 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | methyl 4-[(4-morpholin-4-yl-2,3-dihydro-1H-inden-1-yl)carbamoylamino]indazole-1-carboxylate |
| SMILES | COC(=O)n1ncc2c(NC(=O)NC3CCc4c3cccc4N3CCOCC3)cccc21 |
| InChI | InChI=1S/C23H25N5O4/c1-31-23(30)28-21-7-3-5-18(17(21)14-24-28)25-22(29)26-19-9-8-16-15(19)4-2-6-20(16)27-10-12-32-13-11-27/h2-7,14,19H,8-13H2,1H3,(H2,25,26,29) |
| InChIKey | UVPSPECMYNRLHF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 4-[(4-morpholin-4-yl-2,3-dihydro-1H-inden-1-yl)carbamoylamino]indazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(4-morpholin-4-yl-2,3-dihydro-1H-inden-1-yl)carbamoylamino]indazole-1-carboxylate?
The IUPAC name of methyl 4-[(4-morpholin-4-yl-2,3-dihydro-1H-inden-1-yl)carbamoylamino]indazole-1-carboxylate (CID 67189904) is methyl 4-[(4-morpholin-4-yl-2,3-dihydro-1H-inden-1-yl)carbamoylamino]indazole-1-carboxylate.
What is the SMILES notation for methyl 4-[(4-morpholin-4-yl-2,3-dihydro-1H-inden-1-yl)carbamoylamino]indazole-1-carboxylate?
The canonical SMILES for methyl 4-[(4-morpholin-4-yl-2,3-dihydro-1H-inden-1-yl)carbamoylamino]indazole-1-carboxylate is COC(=O)n1ncc2c(NC(=O)NC3CCc4c3cccc4N3CCOCC3)cccc21.
What is the InChIKey of methyl 4-[(4-morpholin-4-yl-2,3-dihydro-1H-inden-1-yl)carbamoylamino]indazole-1-carboxylate?
The InChIKey is UVPSPECMYNRLHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25N5O4/c1-31-23(30)28-21-7-3-5-18(17(21)14-24-28)25-22(29)26-19-9-8-16-15(19)4-2-6-20(16)27-10-12-32-13-11-27/h2-7,14,19H,8-13H2,1H3,(H2,25,26,29).
What are the key properties of methyl 4-[(4-morpholin-4-yl-2,3-dihydro-1H-inden-1-yl)carbamoylamino]indazole-1-carboxylate?
methyl 4-[(4-morpholin-4-yl-2,3-dihydro-1H-inden-1-yl)carbamoylamino]indazole-1-carboxylate has a molecular weight of 435.48 g/mol, XLogP of 3.30, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(4-morpholin-4-yl-2,3-dihydro-1H-inden-1-yl)carbamoylamino]indazole-1-carboxylate is sourced from PubChem (CID 67189904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).