C14H16N2O — CID 67202490
7-methoxy-4-methyl-1,2,3,3a,4,8b-hexahydroindeno[1,2-c]pyrrole-6-carbonitrile (PubChem CID 67202490) has the molecular formula C14H16N2O and a molecular weight of 228.29 g/mol. Its IUPAC name is 7-methoxy-4-methyl-1,2,3,3a,4,8b-hexahydroindeno[1,2-c]pyrrole-6-carbonitrile.
| Compound Name | 7-methoxy-4-methyl-1,2,3,3a,4,8b-hexahydroindeno[1,2-c]pyrrole-6-carbonitrile |
|---|---|
| PubChem CID | 67202490 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 7-methoxy-4-methyl-1,2,3,3a,4,8b-hexahydroindeno[1,2-c]pyrrole-6-carbonitrile |
| SMILES | COc1cc2c(cc1C#N)C(C)C1CNCC21 |
| InChI | InChI=1S/C14H16N2O/c1-8-10-3-9(5-15)14(17-2)4-11(10)13-7-16-6-12(8)13/h3-4,8,12-13,16H,6-7H2,1-2H3 |
| InChIKey | CVCBVBLSTQQHRH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |