C21H32O4 — CID 67202973
(3S,9R,10S,11R,13S,14S,17R)-17-[(1R)-1-hydroxyethyl]-10,13-dimethyl-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,11,17-triol (PubChem CID 67202973) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is (3S,9R,10S,11R,13S,14S,17R)-17-[(1R)-1-hydroxyethyl]-10,13-dimethyl-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,11,17-triol.
| Compound Name | (3S,9R,10S,11R,13S,14S,17R)-17-[(1R)-1-hydroxyethyl]-10,13-dimethyl-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,11,17-triol |
|---|---|
| PubChem CID | 67202973 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | (3S,9R,10S,11R,13S,14S,17R)-17-[(1R)-1-hydroxyethyl]-10,13-dimethyl-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,11,17-triol |
| SMILES | C[C@@H](O)[C@@]1(O)CC[C@H]2C3=CC=C4C[C@@H](O)CC[C@@]4(C)[C@@H]3[C@H](O)C[C@@]21C |
| InChI | InChI=1S/C21H32O4/c1-12(22)21(25)9-7-16-15-5-4-13-10-14(23)6-8-19(13,2)18(15)17(24)11-20(16,21)3/h4-5,12,14,16-18,22-25H,6-11H2,1-3H3/t12-,14+,16+,17-,18+,19-,20+,21+/m1/s1 |
| InChIKey | LYEXUULFEXSQPW-ZTKKWTLLSA-N |
| XLogP | 2.31 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |