About 4-hydroxy-3-[2-(trifluoromethyl)phenyl]sulfanylpyrano[3,2-b]pyridin-2-one
4-hydroxy-3-[2-(trifluoromethyl)phenyl]sulfanylpyrano[3,2-b]pyridin-2-one (PubChem CID 67204848) has the molecular formula C15H8F3NO3S
and a molecular weight of 339.29 g/mol. Its IUPAC name is 4-hydroxy-3-[2-(trifluoromethyl)phenyl]sulfanylpyrano[3,2-b]pyridin-2-one.
Molecular Properties
| Compound Name | 4-hydroxy-3-[2-(trifluoromethyl)phenyl]sulfanylpyrano[3,2-b]pyridin-2-one |
| PubChem CID | 67204848 |
| Molecular Formula | C15H8F3NO3S |
| Molecular Weight | 339.29 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | 4-hydroxy-3-[2-(trifluoromethyl)phenyl]sulfanylpyrano[3,2-b]pyridin-2-one |
| SMILES | O=c1oc2cccnc2c(O)c1Sc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H8F3NO3S/c16-15(17,18)8-4-1-2-6-10(8)23-13-12(20)11-9(22-14(13)21)5-3-7-19-11/h1-7,20H |
| InChIKey | DSYSNBKRJUWIKJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.29 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-hydroxy-3-[2-(trifluoromethyl)phenyl]sulfanylpyrano[3,2-b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-3-[2-(trifluoromethyl)phenyl]sulfanylpyrano[3,2-b]pyridin-2-one?
The IUPAC name of 4-hydroxy-3-[2-(trifluoromethyl)phenyl]sulfanylpyrano[3,2-b]pyridin-2-one (CID 67204848) is 4-hydroxy-3-[2-(trifluoromethyl)phenyl]sulfanylpyrano[3,2-b]pyridin-2-one.
What is the SMILES notation for 4-hydroxy-3-[2-(trifluoromethyl)phenyl]sulfanylpyrano[3,2-b]pyridin-2-one?
The canonical SMILES for 4-hydroxy-3-[2-(trifluoromethyl)phenyl]sulfanylpyrano[3,2-b]pyridin-2-one is O=c1oc2cccnc2c(O)c1Sc1ccccc1C(F)(F)F.
What is the InChIKey of 4-hydroxy-3-[2-(trifluoromethyl)phenyl]sulfanylpyrano[3,2-b]pyridin-2-one?
The InChIKey is DSYSNBKRJUWIKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8F3NO3S/c16-15(17,18)8-4-1-2-6-10(8)23-13-12(20)11-9(22-14(13)21)5-3-7-19-11/h1-7,20H.
What are the key properties of 4-hydroxy-3-[2-(trifluoromethyl)phenyl]sulfanylpyrano[3,2-b]pyridin-2-one?
4-hydroxy-3-[2-(trifluoromethyl)phenyl]sulfanylpyrano[3,2-b]pyridin-2-one has a molecular weight of 339.29 g/mol, XLogP of 4.06, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-3-[2-(trifluoromethyl)phenyl]sulfanylpyrano[3,2-b]pyridin-2-one is sourced from PubChem (CID 67204848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).