C22H26FN3 — CID 67206409
8-ethyl-5-[2-(5-fluoro-3-pyridinyl)ethyl]-2,6-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indole (PubChem CID 67206409) has the molecular formula C22H26FN3 and a molecular weight of 351.47 g/mol. Its IUPAC name is 8-ethyl-5-[2-(5-fluoro-3-pyridinyl)ethyl]-2,6-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indole.
| Compound Name | 8-ethyl-5-[2-(5-fluoro-3-pyridinyl)ethyl]-2,6-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 67206409 |
| Molecular Formula | C22H26FN3 |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | 8-ethyl-5-[2-(5-fluoro-3-pyridinyl)ethyl]-2,6-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indole |
| SMILES | CCc1cc(C)c2c(c1)c1c(n2CCc2cncc(F)c2)CCN(C)C1 |
| InChI | InChI=1S/C22H26FN3/c1-4-16-9-15(2)22-19(11-16)20-14-25(3)7-6-21(20)26(22)8-5-17-10-18(23)13-24-12-17/h9-13H,4-8,14H2,1-3H3 |
| InChIKey | RLMRLCCLOHKJTK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|