C20H24N4O2 — CID 67208629
N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-2-[(Z)-1-amino-3-phenylprop-1-en-2-yl]oxyprop-2-enamide (PubChem CID 67208629) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-2-[(Z)-1-amino-3-phenylprop-1-en-2-yl]oxyprop-2-enamide.
| Compound Name | N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-2-[(Z)-1-amino-3-phenylprop-1-en-2-yl]oxyprop-2-enamide |
|---|---|
| PubChem CID | 67208629 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-2-[(Z)-1-amino-3-phenylprop-1-en-2-yl]oxyprop-2-enamide |
| SMILES | C=C(O/C(=C\N)Cc1ccccc1)C(=O)NCc1c(C)cc(N)nc1C |
| InChI | InChI=1S/C20H24N4O2/c1-13-9-19(22)24-14(2)18(13)12-23-20(25)15(3)26-17(11-21)10-16-7-5-4-6-8-16/h4-9,11H,3,10,12,21H2,1-2H3,(H2,22,24)(H,23,25)/b17-11- |
| InChIKey | DPWBLAYRTZCQLH-BOPFTXTBSA-N |
| XLogP | 2.47 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|