C23H26N6O — CID 67208656
(Z)-2-amino-N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-3-[(methylideneamino)-(naphthalen-1-ylmethyl)amino]prop-2-enamide (PubChem CID 67208656) has the molecular formula C23H26N6O and a molecular weight of 402.50 g/mol. Its IUPAC name is (Z)-2-amino-N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-3-[(methylideneamino)-(naphthalen-1-ylmethyl)amino]prop-2-enamide.
| Compound Name | (Z)-2-amino-N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-3-[(methylideneamino)-(naphthalen-1-ylmethyl)amino]prop-2-enamide |
|---|---|
| PubChem CID | 67208656 |
| Molecular Formula | C23H26N6O |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | (Z)-2-amino-N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-3-[(methylideneamino)-(naphthalen-1-ylmethyl)amino]prop-2-enamide |
| SMILES | C=NN(/C=C(\N)C(=O)NCc1c(C)cc(N)nc1C)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C23H26N6O/c1-15-11-22(25)28-16(2)20(15)12-27-23(30)21(24)14-29(26-3)13-18-9-6-8-17-7-4-5-10-19(17)18/h4-11,14H,3,12-13,24H2,1-2H3,(H2,25,28)(H,27,30)/b21-14- |
| InChIKey | OSHFEEYRTKDMOZ-STZFKDTASA-N |
| XLogP | 2.97 |
| TPSA | 109.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|