C33H29N3O — CID 67211131
(2E)-2-[6-[[6-(furan-2-yl)-4-methyl-2-propylbenzimidazol-1-yl]methyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]acetonitrile (PubChem CID 67211131) has the molecular formula C33H29N3O and a molecular weight of 483.62 g/mol. Its IUPAC name is (2E)-2-[6-[[6-(furan-2-yl)-4-methyl-2-propylbenzimidazol-1-yl]methyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]acetonitrile.
| Compound Name | (2E)-2-[6-[[6-(furan-2-yl)-4-methyl-2-propylbenzimidazol-1-yl]methyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]acetonitrile |
|---|---|
| PubChem CID | 67211131 |
| Molecular Formula | C33H29N3O |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | (2E)-2-[6-[[6-(furan-2-yl)-4-methyl-2-propylbenzimidazol-1-yl]methyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]acetonitrile |
| SMILES | CCCc1nc2c(C)cc(-c3ccco3)cc2n1Cc1ccc2c(c1)CCc1ccccc1/C2=C\C#N |
| InChI | InChI=1S/C33H29N3O/c1-3-7-32-35-33-22(2)18-26(31-10-6-17-37-31)20-30(33)36(32)21-23-11-14-28-25(19-23)13-12-24-8-4-5-9-27(24)29(28)15-16-34/h4-6,8-11,14-15,17-20H,3,7,12-13,21H2,1-2H3/b29-15+ |
| InChIKey | ZPJIIMDSVUCKNN-WKULSOCRSA-N |
| XLogP | 7.66 |
| TPSA | 54.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|