C36H32N6O2 — CID 67211241
methyl 3-[4-methyl-6-phenyl-1-[[(2E)-2-(2H-tetrazol-5-ylmethylidene)-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]methyl]benzimidazol-2-yl]propanoate (PubChem CID 67211241) has the molecular formula C36H32N6O2 and a molecular weight of 580.69 g/mol. Its IUPAC name is methyl 3-[4-methyl-6-phenyl-1-[[(2E)-2-(2H-tetrazol-5-ylmethylidene)-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]methyl]benzimidazol-2-yl]propanoate.
| Compound Name | methyl 3-[4-methyl-6-phenyl-1-[[(2E)-2-(2H-tetrazol-5-ylmethylidene)-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]methyl]benzimidazol-2-yl]propanoate |
|---|---|
| PubChem CID | 67211241 |
| Molecular Formula | C36H32N6O2 |
| Molecular Weight | 580.69 g/mol |
| Exact Mass | 580.26 |
| IUPAC Name | methyl 3-[4-methyl-6-phenyl-1-[[(2E)-2-(2H-tetrazol-5-ylmethylidene)-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]methyl]benzimidazol-2-yl]propanoate |
| SMILES | COC(=O)CCc1nc2c(C)cc(-c3ccccc3)cc2n1Cc1ccc2c(c1)CCc1ccccc1/C2=C\c1nn[nH]n1 |
| InChI | InChI=1S/C36H32N6O2/c1-23-18-28(25-8-4-3-5-9-25)20-32-36(23)37-34(16-17-35(43)44-2)42(32)22-24-12-15-30-27(19-24)14-13-26-10-6-7-11-29(26)31(30)21-33-38-40-41-39-33/h3-12,15,18-21H,13-14,16-17,22H2,1-2H3,(H,38,39,40,41)/b31-21+ |
| InChIKey | MGYGMPQQKRAWAB-NJZRLIGZSA-N |
| XLogP | 6.37 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.69 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'} |
|---|