C36H31N3O2 — CID 67210402
methyl 3-[1-[[(2E)-2-(cyanomethylidene)-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]methyl]-4-methyl-6-phenylbenzimidazol-2-yl]propanoate (PubChem CID 67210402) has the molecular formula C36H31N3O2 and a molecular weight of 537.66 g/mol. Its IUPAC name is methyl 3-[1-[[(2E)-2-(cyanomethylidene)-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]methyl]-4-methyl-6-phenylbenzimidazol-2-yl]propanoate.
| Compound Name | methyl 3-[1-[[(2E)-2-(cyanomethylidene)-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]methyl]-4-methyl-6-phenylbenzimidazol-2-yl]propanoate |
|---|---|
| PubChem CID | 67210402 |
| Molecular Formula | C36H31N3O2 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | methyl 3-[1-[[(2E)-2-(cyanomethylidene)-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]methyl]-4-methyl-6-phenylbenzimidazol-2-yl]propanoate |
| SMILES | COC(=O)CCc1nc2c(C)cc(-c3ccccc3)cc2n1Cc1ccc2c(c1)CCc1ccccc1/C2=C\C#N |
| InChI | InChI=1S/C36H31N3O2/c1-24-20-29(26-8-4-3-5-9-26)22-33-36(24)38-34(16-17-35(40)41-2)39(33)23-25-12-15-31-28(21-25)14-13-27-10-6-7-11-30(27)32(31)18-19-37/h3-12,15,18,20-22H,13-14,16-17,23H2,1-2H3/b32-18+ |
| InChIKey | PNOFIAVJRHGQDC-KCSSXMTESA-N |
| XLogP | 7.22 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|