C6H4ClN3O — CID 67212155
6-chloro-1,5-dihydroimidazo[4,5-c]pyridin-4-one (PubChem CID 67212155) has the molecular formula C6H4ClN3O and a molecular weight of 169.57 g/mol. Its IUPAC name is 6-chloro-1,5-dihydroimidazo[4,5-c]pyridin-4-one.
| Compound Name | 6-chloro-1,5-dihydroimidazo[4,5-c]pyridin-4-one |
|---|---|
| PubChem CID | 67212155 |
| Molecular Formula | C6H4ClN3O |
| Molecular Weight | 169.57 g/mol |
| Exact Mass | 169.00 |
| IUPAC Name | 6-chloro-1,5-dihydroimidazo[4,5-c]pyridin-4-one |
| SMILES | O=c1[nH]c(Cl)cc2[nH]cnc12 |
| InChI | InChI=1S/C6H4ClN3O/c7-4-1-3-5(6(11)10-4)9-2-8-3/h1-2H,(H,8,9)(H,10,11) |
| InChIKey | HIEGVVVCZYVIBQ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.57 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|