C20H22N8O4 — CID 67213237
(3R,4R)-3-methyl-4-[[6-[4-(1-methylpyrazol-4-yl)-2-nitroanilino]pyrazin-2-yl]amino]pyrrolidine-1-carboxylic acid (PubChem CID 67213237) has the molecular formula C20H22N8O4 and a molecular weight of 438.45 g/mol. Its IUPAC name is (3R,4R)-3-methyl-4-[[6-[4-(1-methylpyrazol-4-yl)-2-nitroanilino]pyrazin-2-yl]amino]pyrrolidine-1-carboxylic acid.
| Compound Name | (3R,4R)-3-methyl-4-[[6-[4-(1-methylpyrazol-4-yl)-2-nitroanilino]pyrazin-2-yl]amino]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 67213237 |
| Molecular Formula | C20H22N8O4 |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | (3R,4R)-3-methyl-4-[[6-[4-(1-methylpyrazol-4-yl)-2-nitroanilino]pyrazin-2-yl]amino]pyrrolidine-1-carboxylic acid |
| SMILES | C[C@@H]1CN(C(=O)O)C[C@@H]1Nc1cncc(Nc2ccc(-c3cnn(C)c3)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C20H22N8O4/c1-12-9-27(20(29)30)11-16(12)24-19-8-21-7-18(25-19)23-15-4-3-13(5-17(15)28(31)32)14-6-22-26(2)10-14/h3-8,10,12,16H,9,11H2,1-2H3,(H,29,30)(H2,23,24,25)/t12-,16+/m1/s1 |
| InChIKey | WKGDCONXGHYKEK-WBMJQRKESA-N |
| XLogP | 2.94 |
| TPSA | 151.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|