C24H30N8O4 — CID 58303409
tert-butyl (3R,4R)-3-methyl-4-[[6-[4-(1-methylpyrazol-4-yl)-2-nitroanilino]pyrazin-2-yl]amino]pyrrolidine-1-carboxylate (PubChem CID 58303409) has the molecular formula C24H30N8O4 and a molecular weight of 494.56 g/mol. Its IUPAC name is tert-butyl (3R,4R)-3-methyl-4-[[6-[4-(1-methylpyrazol-4-yl)-2-nitroanilino]pyrazin-2-yl]amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4R)-3-methyl-4-[[6-[4-(1-methylpyrazol-4-yl)-2-nitroanilino]pyrazin-2-yl]amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58303409 |
| Molecular Formula | C24H30N8O4 |
| Molecular Weight | 494.56 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | tert-butyl (3R,4R)-3-methyl-4-[[6-[4-(1-methylpyrazol-4-yl)-2-nitroanilino]pyrazin-2-yl]amino]pyrrolidine-1-carboxylate |
| SMILES | C[C@@H]1CN(C(=O)OC(C)(C)C)C[C@@H]1Nc1cncc(Nc2ccc(-c3cnn(C)c3)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C24H30N8O4/c1-15-12-31(23(33)36-24(2,3)4)14-19(15)28-22-11-25-10-21(29-22)27-18-7-6-16(8-20(18)32(34)35)17-9-26-30(5)13-17/h6-11,13,15,19H,12,14H2,1-5H3,(H2,27,28,29)/t15-,19+/m1/s1 |
| InChIKey | AUKHRAPZQXSZGH-BEFAXECRSA-N |
| XLogP | 4.20 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.56 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|